![2-[(4-fluorophenyl)methyl]-5-methylpyrazole-3-carboxylic acid (CAS: 618070-43-2) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0713052.png "2-[(4-fluorophenyl)methyl]-5-methylpyrazole-3-carboxylic acid chemical structure")
2-[(4-fluorophenyl)methyl]-5-methylpyrazole-3-carboxylic acid
Catalog No: FT-0713052
CAS No: 618070-43-2
- Chemical Name: 2-[(4-fluorophenyl)methyl]-5-methylpyrazole-3-carboxylic acid
- Molecular Formula: C12H11FN2O2
- Molecular Weight: 234.23
- InChI Key: LCNKEPNSKFFGPO-UHFFFAOYSA-N
- InChI: InChI=1S/C12H11FN2O2/c1-8-6-11(12(16)17)15(14-8)7-9-2-4-10(13)5-3-9/h2-6H,7H2,1H3,(H,16,17)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 618070-43-2 |
|---|---|
| MF: | C12H11FN2O2 |
| Density: | 1.29g/cm3 |
| Flash_Point: | 213.8ºC |
| Melting_Point: | 194-198ºC(lit.) |
| Product_Name: | 2-[(4-fluorophenyl)methyl]-5-methylpyrazole-3-carboxylic acid |
| Symbol: | GHS07 |
| Bolling_Point: | 429.9ºC at 760 mmHg |
| FW: | 234.22600 |
| Density: | 1.29g/cm3 |
|---|---|
| MF: | C12H11FN2O2 |
| LogP: | 2.07710 |
| Melting_Point: | 194-198ºC(lit.) |
| Exact_Mass: | 234.08000 |
| Bolling_Point: | 429.9ºC at 760 mmHg |
| Flash_Point: | 213.8ºC |
| FW: | 234.22600 |
| Refractive_Index: | 1.591 |
| PSA: | 55.12000 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety_Statements: | 22-24/25 |
| Symbol: | GHS07 |
| Warning_Statement: | P305 + P351 + P338 |
| HS_Code: | 2933199090 |
| RIDADR: | NONH for all modes of transport |
